Overview
Delta Sleep Inducing Peptide (DSIP) is listed in PubChem as Delta Sleep-Inducing Peptide (CID 68816), with the molecular formula C35H48N10O15 and a molecular weight of 848.8 g/mol. PubChem lists its sequence as H-Trp-Ala-Gly-Gly-Asp-Ala-Ser-Gly-Glu-OH, a 9-residue peptide. Other names in PubChem include DSIP, Emideltide, Delta-sleep peptide, PDS-4054. It is supplied as a lyophilized powder in sealed 5 mg vials.
Volume pricing: 5+ vials save 5%, 10+ vials save 10%. It applies automatically in the cart and stacks with coupon codes.
Molecular profile
| PubChem name | Delta Sleep-Inducing Peptide |
|---|---|
| Also known as (PubChem) | DSIP, Emideltide, Delta-sleep peptide, PDS-4054 |
| Sequence | H-Trp-Ala-Gly-Gly-Asp-Ala-Ser-Gly-Glu-OH |
| Length | 9 residues |
| Residue composition | Gly ×3, Ala ×2, Asp, Glu, Ser, Trp |
| Molecular formula | C35H48N10O15 |
| Molecular weight | 848.8 g/mol |
| CAS number | 62568-57-4 |
| PubChem CID | 68816 |
Computed properties (PubChem)
| Exact mass | 848.3301 Da |
|---|---|
| Monoisotopic mass | 848.3301 Da |
| XLogP3 | −7.1 |
| Topological polar surface area | 407 Ų |
| Hydrogen bond donors | 14 |
| Hydrogen bond acceptors | 16 |
| Rotatable bonds | 25 |
| Heavy atoms | 60 |
| Formal charge | 0 |
| Complexity | 1610 |
| Defined stereocenters | 6 of 6 |
Identifiers (PubChem)
| InChIKey | ZRZROXNBKJAOKB-GFVHOAGBSA-N |
|---|---|
| SMILES | C[C@@H](C(=O)NCC(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)O)NC(=O)[C@H](CC1=CNC2=CC=CC=C21)N |
| UNII | YN28Z5YZ73 |
| ChEMBL ID | CHEMBL2104403 |
IUPAC name (PubChem)
(2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoyl]amino]acetyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]propanoyl]amino]-3-hydroxypropanoyl]amino]acetyl]amino]pentanedioic acid
Source: PubChem compound 68816
